C19H23ClFN2O6P — CID 138693940
[(3R)-1-methylpyrrolidin-3-yl] N-[2-(3-chloro-4-fluorophenyl)phenyl]-N-methylcarbamate;phosphoric acid (PubChem CID 138693940) has the molecular formula C19H23ClFN2O6P and a molecular weight of 460.83 g/mol. Its IUPAC name is [(3R)-1-methylpyrrolidin-3-yl] N-[2-(3-chloro-4-fluorophenyl)phenyl]-N-methylcarbamate;phosphoric acid.
| Compound Name | [(3R)-1-methylpyrrolidin-3-yl] N-[2-(3-chloro-4-fluorophenyl)phenyl]-N-methylcarbamate;phosphoric acid |
|---|---|
| PubChem CID | 138693940 |
| Molecular Formula | C19H23ClFN2O6P |
| Molecular Weight | 460.83 g/mol |
| Exact Mass | 460.10 |
| IUPAC Name | [(3R)-1-methylpyrrolidin-3-yl] N-[2-(3-chloro-4-fluorophenyl)phenyl]-N-methylcarbamate;phosphoric acid |
| SMILES | CN1CC[C@@H](OC(=O)N(C)c2ccccc2-c2ccc(F)c(Cl)c2)C1.O=P(O)(O)O |
| InChI | InChI=1S/C19H20ClFN2O2.H3O4P/c1-22-10-9-14(12-22)25-19(24)23(2)18-6-4-3-5-15(18)13-7-8-17(21)16(20)11-13;1-5(2,3)4/h3-8,11,14H,9-10,12H2,1-2H3;(H3,1,2,3,4)/t14-;/m1./s1 |
| InChIKey | LFRJYAGUOTXTND-PFEQFJNWSA-N |
| XLogP | 3.49 |
| TPSA | 110.54 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.83 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|