C22H30FNO4S — CID 138694342
2-[4-(dibenzylamino)-3-fluoro-2-methylbutan-2-yl]oxyethyl methanesulfonate (PubChem CID 138694342) has the molecular formula C22H30FNO4S and a molecular weight of 423.55 g/mol. Its IUPAC name is 2-[4-(dibenzylamino)-3-fluoro-2-methylbutan-2-yl]oxyethyl methanesulfonate.
| Compound Name | 2-[4-(dibenzylamino)-3-fluoro-2-methylbutan-2-yl]oxyethyl methanesulfonate |
|---|---|
| PubChem CID | 138694342 |
| Molecular Formula | C22H30FNO4S |
| Molecular Weight | 423.55 g/mol |
| Exact Mass | 423.19 |
| IUPAC Name | 2-[4-(dibenzylamino)-3-fluoro-2-methylbutan-2-yl]oxyethyl methanesulfonate |
| SMILES | CC(C)(OCCOS(C)(=O)=O)C(F)CN(Cc1ccccc1)Cc1ccccc1 |
| InChI | InChI=1S/C22H30FNO4S/c1-22(2,27-14-15-28-29(3,25)26)21(23)18-24(16-19-10-6-4-7-11-19)17-20-12-8-5-9-13-20/h4-13,21H,14-18H2,1-3H3 |
| InChIKey | QGYMAZYGLKPJNC-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.55 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|