C21H29FN2O — CID 138694639
3-(2-aminoethoxy)-N,N-dibenzyl-2-fluoro-3-methylbutan-1-amine (PubChem CID 138694639) has the molecular formula C21H29FN2O and a molecular weight of 344.47 g/mol. Its IUPAC name is 3-(2-aminoethoxy)-N,N-dibenzyl-2-fluoro-3-methylbutan-1-amine.
| Compound Name | 3-(2-aminoethoxy)-N,N-dibenzyl-2-fluoro-3-methylbutan-1-amine |
|---|---|
| PubChem CID | 138694639 |
| Molecular Formula | C21H29FN2O |
| Molecular Weight | 344.47 g/mol |
| Exact Mass | 344.23 |
| IUPAC Name | 3-(2-aminoethoxy)-N,N-dibenzyl-2-fluoro-3-methylbutan-1-amine |
| SMILES | CC(C)(OCCN)C(F)CN(Cc1ccccc1)Cc1ccccc1 |
| InChI | InChI=1S/C21H29FN2O/c1-21(2,25-14-13-23)20(22)17-24(15-18-9-5-3-6-10-18)16-19-11-7-4-8-12-19/h3-12,20H,13-17,23H2,1-2H3 |
| InChIKey | BHOHSWIVESJZLT-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 38.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.47 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |