C16H24FNO — CID 138698835
(2E,3E,5E)-2-butylidene-5-fluoro-3-(2-methylbut-1-enyl)hepta-3,5-dienamide (PubChem CID 138698835) has the molecular formula C16H24FNO and a molecular weight of 265.37 g/mol. Its IUPAC name is (2E,3E,5E)-2-butylidene-5-fluoro-3-(2-methylbut-1-enyl)hepta-3,5-dienamide.
| Compound Name | (2E,3E,5E)-2-butylidene-5-fluoro-3-(2-methylbut-1-enyl)hepta-3,5-dienamide |
|---|---|
| PubChem CID | 138698835 |
| Molecular Formula | C16H24FNO |
| Molecular Weight | 265.37 g/mol |
| Exact Mass | 265.18 |
| IUPAC Name | (2E,3E,5E)-2-butylidene-5-fluoro-3-(2-methylbut-1-enyl)hepta-3,5-dienamide |
| SMILES | C/C=C(F)\C=C(C=C(C)CC)\C(=C/CCC)C(N)=O |
| InChI | InChI=1S/C16H24FNO/c1-5-8-9-15(16(18)19)13(10-12(4)6-2)11-14(17)7-3/h7,9-11H,5-6,8H2,1-4H3,(H2,18,19)/b12-10?,13-11+,14-7+,15-9+ |
| InChIKey | FIHBEVOEMNNXJK-JZSZCJFYSA-N |
| XLogP | 4.35 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.37 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|