C13H21NO — CID 142170609
(2Z,3Z)-2-butylidene-5,6-dimethylhepta-3,5-dienamide (PubChem CID 142170609) has the molecular formula C13H21NO and a molecular weight of 207.32 g/mol. Its IUPAC name is (2Z,3Z)-2-butylidene-5,6-dimethylhepta-3,5-dienamide.
| Compound Name | (2Z,3Z)-2-butylidene-5,6-dimethylhepta-3,5-dienamide |
|---|---|
| PubChem CID | 142170609 |
| Molecular Formula | C13H21NO |
| Molecular Weight | 207.32 g/mol |
| Exact Mass | 207.16 |
| IUPAC Name | (2Z,3Z)-2-butylidene-5,6-dimethylhepta-3,5-dienamide |
| SMILES | CCC/C=C(/C=C\C(C)=C(C)C)C(N)=O |
| InChI | InChI=1S/C13H21NO/c1-5-6-7-12(13(14)15)9-8-11(4)10(2)3/h7-9H,5-6H2,1-4H3,(H2,14,15)/b9-8-,12-7- |
| InChIKey | UGHBFTQZAQDSRM-JRIAKMGRSA-N |
| XLogP | 3.11 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.32 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|