C22H29N3OS2 — CID 138707854
5-(dithiolan-3-yl)-1-[3-(isoquinolin-5-ylamino)piperidin-1-yl]pentan-1-one (PubChem CID 138707854) has the molecular formula C22H29N3OS2 and a molecular weight of 415.63 g/mol. Its IUPAC name is 5-(dithiolan-3-yl)-1-[3-(isoquinolin-5-ylamino)piperidin-1-yl]pentan-1-one.
| Compound Name | 5-(dithiolan-3-yl)-1-[3-(isoquinolin-5-ylamino)piperidin-1-yl]pentan-1-one |
|---|---|
| PubChem CID | 138707854 |
| Molecular Formula | C22H29N3OS2 |
| Molecular Weight | 415.63 g/mol |
| Exact Mass | 415.18 |
| IUPAC Name | 5-(dithiolan-3-yl)-1-[3-(isoquinolin-5-ylamino)piperidin-1-yl]pentan-1-one |
| SMILES | O=C(CCCCC1CCSS1)N1CCCC(Nc2cccc3cnccc23)C1 |
| InChI | InChI=1S/C22H29N3OS2/c26-22(9-2-1-7-19-11-14-27-28-19)25-13-4-6-18(16-25)24-21-8-3-5-17-15-23-12-10-20(17)21/h3,5,8,10,12,15,18-19,24H,1-2,4,6-7,9,11,13-14,16H2 |
| InChIKey | UHTHJNNSWZWKQF-UHFFFAOYSA-N |
| XLogP | 5.35 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.63 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|