C21H23N3O2 — CID 138711566
N-(2,3-dihydro-1,4-benzodioxin-6-yl)-6-methyl-2,3,4,5-tetrahydro-1H-azepino[4,5-b]indol-8-amine (PubChem CID 138711566) has the molecular formula C21H23N3O2 and a molecular weight of 349.43 g/mol. Its IUPAC name is N-(2,3-dihydro-1,4-benzodioxin-6-yl)-6-methyl-2,3,4,5-tetrahydro-1H-azepino[4,5-b]indol-8-amine.
| Compound Name | N-(2,3-dihydro-1,4-benzodioxin-6-yl)-6-methyl-2,3,4,5-tetrahydro-1H-azepino[4,5-b]indol-8-amine |
|---|---|
| PubChem CID | 138711566 |
| Molecular Formula | C21H23N3O2 |
| Molecular Weight | 349.43 g/mol |
| Exact Mass | 349.18 |
| IUPAC Name | N-(2,3-dihydro-1,4-benzodioxin-6-yl)-6-methyl-2,3,4,5-tetrahydro-1H-azepino[4,5-b]indol-8-amine |
| SMILES | Cn1c2c(c3ccc(Nc4ccc5c(c4)OCCO5)cc31)CCNCC2 |
| InChI | InChI=1S/C21H23N3O2/c1-24-18-7-9-22-8-6-17(18)16-4-2-14(12-19(16)24)23-15-3-5-20-21(13-15)26-11-10-25-20/h2-5,12-13,22-23H,6-11H2,1H3 |
| InChIKey | AXOPEVGIQMPYDL-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 47.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.43 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|