C11H19N3O3 — CID 138711851
(4aR,7aS)-1-ethyl-3-hydroxy-6-propyl-4,4a,5,7a-tetrahydropyrrolo[3,4-d]pyrimidine-2,7-dione (PubChem CID 138711851) has the molecular formula C11H19N3O3 and a molecular weight of 241.29 g/mol. Its IUPAC name is (4aR,7aS)-1-ethyl-3-hydroxy-6-propyl-4,4a,5,7a-tetrahydropyrrolo[3,4-d]pyrimidine-2,7-dione.
| Compound Name | (4aR,7aS)-1-ethyl-3-hydroxy-6-propyl-4,4a,5,7a-tetrahydropyrrolo[3,4-d]pyrimidine-2,7-dione |
|---|---|
| PubChem CID | 138711851 |
| Molecular Formula | C11H19N3O3 |
| Molecular Weight | 241.29 g/mol |
| Exact Mass | 241.14 |
| IUPAC Name | (4aR,7aS)-1-ethyl-3-hydroxy-6-propyl-4,4a,5,7a-tetrahydropyrrolo[3,4-d]pyrimidine-2,7-dione |
| SMILES | CCCN1C[C@@H]2CN(O)C(=O)N(CC)[C@@H]2C1=O |
| InChI | InChI=1S/C11H19N3O3/c1-3-5-12-6-8-7-14(17)11(16)13(4-2)9(8)10(12)15/h8-9,17H,3-7H2,1-2H3/t8-,9+/m1/s1 |
| InChIKey | YXICKPULFCABJL-BDAKNGLRSA-N |
| XLogP | 0.37 |
| TPSA | 64.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.29 |
| LogP ≤ 5 | 0.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'} |
|---|