C18H19ClN6O2S — CID 138713435
2-chloro-6-[(5-ethylsulfanyl-2-pyridinyl)methylamino]-8-(oxolan-3-yl)pteridin-7-one (PubChem CID 138713435) has the molecular formula C18H19ClN6O2S and a molecular weight of 418.91 g/mol. Its IUPAC name is 2-chloro-6-[(5-ethylsulfanyl-2-pyridinyl)methylamino]-8-(oxolan-3-yl)pteridin-7-one.
| Compound Name | 2-chloro-6-[(5-ethylsulfanyl-2-pyridinyl)methylamino]-8-(oxolan-3-yl)pteridin-7-one |
|---|---|
| PubChem CID | 138713435 |
| Molecular Formula | C18H19ClN6O2S |
| Molecular Weight | 418.91 g/mol |
| Exact Mass | 418.10 |
| IUPAC Name | 2-chloro-6-[(5-ethylsulfanyl-2-pyridinyl)methylamino]-8-(oxolan-3-yl)pteridin-7-one |
| SMILES | CCSc1ccc(CNc2nc3cnc(Cl)nc3n(C3CCOC3)c2=O)nc1 |
| InChI | InChI=1S/C18H19ClN6O2S/c1-2-28-13-4-3-11(20-8-13)7-21-15-17(26)25(12-5-6-27-10-12)16-14(23-15)9-22-18(19)24-16/h3-4,8-9,12H,2,5-7,10H2,1H3,(H,21,23) |
| InChIKey | GYUGQALFHXGQHY-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 94.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.91 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |