About 2,8-dibromo-10,10-diphenylphenoxathiine
2,8-dibromo-10,10-diphenylphenoxathiine (PubChem CID 138720140) has the molecular formula C24H16Br2OS
and a molecular weight of 512.27 g/mol. Its IUPAC name is 2,8-dibromo-10,10-diphenylphenoxathiine.
Molecular Properties
| Compound Name | 2,8-dibromo-10,10-diphenylphenoxathiine |
| PubChem CID | 138720140 |
| Molecular Formula | C24H16Br2OS |
| Molecular Weight | 512.27 g/mol |
| Exact Mass | 509.93 |
| IUPAC Name | 2,8-dibromo-10,10-diphenylphenoxathiine |
| SMILES | Brc1ccc2c(c1)S(c1ccccc1)(c1ccccc1)c1cc(Br)ccc1O2 |
| InChI | InChI=1S/C24H16Br2OS/c25-17-11-13-21-23(15-17)28(19-7-3-1-4-8-19,20-9-5-2-6-10-20)24-16-18(26)12-14-22(24)27-21/h1-16H |
| InChIKey | FDTXTILTNUGNFJ-UHFFFAOYSA-N |
| XLogP | 8.66 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 512.27 |
| LogP ≤ 5 | 8.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2,8-dibromo-10,10-diphenylphenoxathiine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,8-dibromo-10,10-diphenylphenoxathiine?
The IUPAC name of 2,8-dibromo-10,10-diphenylphenoxathiine (CID 138720140) is 2,8-dibromo-10,10-diphenylphenoxathiine.
What is the SMILES notation for 2,8-dibromo-10,10-diphenylphenoxathiine?
The canonical SMILES for 2,8-dibromo-10,10-diphenylphenoxathiine is Brc1ccc2c(c1)S(c1ccccc1)(c1ccccc1)c1cc(Br)ccc1O2.
What is the InChIKey of 2,8-dibromo-10,10-diphenylphenoxathiine?
The InChIKey is FDTXTILTNUGNFJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H16Br2OS/c25-17-11-13-21-23(15-17)28(19-7-3-1-4-8-19,20-9-5-2-6-10-20)24-16-18(26)12-14-22(24)27-21/h1-16H.
What are the key properties of 2,8-dibromo-10,10-diphenylphenoxathiine?
2,8-dibromo-10,10-diphenylphenoxathiine has a molecular weight of 512.27 g/mol, XLogP of 8.66, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2,8-dibromo-10,10-diphenylphenoxathiine is sourced from PubChem (CID 138720140), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).