C18H14N4O2 — CID 138721164
benzyl 5-aminoimidazo[1,2-c]quinazoline-2-carboxylate (PubChem CID 138721164) has the molecular formula C18H14N4O2 and a molecular weight of 318.34 g/mol. Its IUPAC name is benzyl 5-aminoimidazo[1,2-c]quinazoline-2-carboxylate.
| Compound Name | benzyl 5-aminoimidazo[1,2-c]quinazoline-2-carboxylate |
|---|---|
| PubChem CID | 138721164 |
| Molecular Formula | C18H14N4O2 |
| Molecular Weight | 318.34 g/mol |
| Exact Mass | 318.11 |
| IUPAC Name | benzyl 5-aminoimidazo[1,2-c]quinazoline-2-carboxylate |
| SMILES | Nc1nc2ccccc2c2nc(C(=O)OCc3ccccc3)cn12 |
| InChI | InChI=1S/C18H14N4O2/c19-18-21-14-9-5-4-8-13(14)16-20-15(10-22(16)18)17(23)24-11-12-6-2-1-3-7-12/h1-10H,11H2,(H2,19,21) |
| InChIKey | HUKJMMHLCDPAIK-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 82.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.34 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |