C13H26N4O4 — CID 138721411
(2S)-2-amino-5-[2-[2-(2-amino-2-oxoethoxy)ethoxy]ethylamino]-N-methylhex-5-enamide (PubChem CID 138721411) has the molecular formula C13H26N4O4 and a molecular weight of 302.38 g/mol. Its IUPAC name is (2S)-2-amino-5-[2-[2-(2-amino-2-oxoethoxy)ethoxy]ethylamino]-N-methylhex-5-enamide.
| Compound Name | (2S)-2-amino-5-[2-[2-(2-amino-2-oxoethoxy)ethoxy]ethylamino]-N-methylhex-5-enamide |
|---|---|
| PubChem CID | 138721411 |
| Molecular Formula | C13H26N4O4 |
| Molecular Weight | 302.38 g/mol |
| Exact Mass | 302.20 |
| IUPAC Name | (2S)-2-amino-5-[2-[2-(2-amino-2-oxoethoxy)ethoxy]ethylamino]-N-methylhex-5-enamide |
| SMILES | C=C(CC[C@H](N)C(=O)NC)NCCOCCOCC(N)=O |
| InChI | InChI=1S/C13H26N4O4/c1-10(3-4-11(14)13(19)16-2)17-5-6-20-7-8-21-9-12(15)18/h11,17H,1,3-9,14H2,2H3,(H2,15,18)(H,16,19)/t11-/m0/s1 |
| InChIKey | IZDYQFBUVREEOL-NSHDSACASA-N |
| XLogP | -1.54 |
| TPSA | 128.70 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.38 |
| LogP ≤ 5 | -1.54 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|