About 2-methyl-3-[(1Z,3Z)-2-propan-2-ylpenta-1,3-dienyl]pyridine
2-methyl-3-[(1Z,3Z)-2-propan-2-ylpenta-1,3-dienyl]pyridine (PubChem CID 138722170) has the molecular formula C14H19N
and a molecular weight of 201.31 g/mol. Its IUPAC name is 2-methyl-3-[(1Z,3Z)-2-propan-2-ylpenta-1,3-dienyl]pyridine.
Molecular Properties
| Compound Name | 2-methyl-3-[(1Z,3Z)-2-propan-2-ylpenta-1,3-dienyl]pyridine |
| PubChem CID | 138722170 |
| Molecular Formula | C14H19N |
| Molecular Weight | 201.31 g/mol |
| Exact Mass | 201.15 |
| IUPAC Name | 2-methyl-3-[(1Z,3Z)-2-propan-2-ylpenta-1,3-dienyl]pyridine |
| SMILES | C/C=C\C(=C/c1cccnc1C)C(C)C |
| InChI | InChI=1S/C14H19N/c1-5-7-13(11(2)3)10-14-8-6-9-15-12(14)4/h5-11H,1-4H3/b7-5-,13-10+ |
| InChIKey | JAXVRPRNJPYRHI-PBHGGESISA-N |
| XLogP | 4.01 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 201.31 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze 2-methyl-3-[(1Z,3Z)-2-propan-2-ylpenta-1,3-dienyl]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methyl-3-[(1Z,3Z)-2-propan-2-ylpenta-1,3-dienyl]pyridine?
The IUPAC name of 2-methyl-3-[(1Z,3Z)-2-propan-2-ylpenta-1,3-dienyl]pyridine (CID 138722170) is 2-methyl-3-[(1Z,3Z)-2-propan-2-ylpenta-1,3-dienyl]pyridine.
What is the SMILES notation for 2-methyl-3-[(1Z,3Z)-2-propan-2-ylpenta-1,3-dienyl]pyridine?
The canonical SMILES for 2-methyl-3-[(1Z,3Z)-2-propan-2-ylpenta-1,3-dienyl]pyridine is C/C=C\C(=C/c1cccnc1C)C(C)C.
What is the InChIKey of 2-methyl-3-[(1Z,3Z)-2-propan-2-ylpenta-1,3-dienyl]pyridine?
The InChIKey is JAXVRPRNJPYRHI-PBHGGESISA-N. The full InChI is InChI=1S/C14H19N/c1-5-7-13(11(2)3)10-14-8-6-9-15-12(14)4/h5-11H,1-4H3/b7-5-,13-10+.
What are the key properties of 2-methyl-3-[(1Z,3Z)-2-propan-2-ylpenta-1,3-dienyl]pyridine?
2-methyl-3-[(1Z,3Z)-2-propan-2-ylpenta-1,3-dienyl]pyridine has a molecular weight of 201.31 g/mol, XLogP of 4.01, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methyl-3-[(1Z,3Z)-2-propan-2-ylpenta-1,3-dienyl]pyridine is sourced from PubChem (CID 138722170), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).