C17H20F3IN2O — CID 138722911
2,2,2-trifluoro-N-[(2R)-2-(4-iodophenyl)cyclopropyl]-N-(piperidin-4-ylmethyl)acetamide (PubChem CID 138722911) has the molecular formula C17H20F3IN2O and a molecular weight of 452.26 g/mol. Its IUPAC name is 2,2,2-trifluoro-N-[(2R)-2-(4-iodophenyl)cyclopropyl]-N-(piperidin-4-ylmethyl)acetamide.
| Compound Name | 2,2,2-trifluoro-N-[(2R)-2-(4-iodophenyl)cyclopropyl]-N-(piperidin-4-ylmethyl)acetamide |
|---|---|
| PubChem CID | 138722911 |
| Molecular Formula | C17H20F3IN2O |
| Molecular Weight | 452.26 g/mol |
| Exact Mass | 452.06 |
| IUPAC Name | 2,2,2-trifluoro-N-[(2R)-2-(4-iodophenyl)cyclopropyl]-N-(piperidin-4-ylmethyl)acetamide |
| SMILES | O=C(N(CC1CCNCC1)C1C[C@@H]1c1ccc(I)cc1)C(F)(F)F |
| InChI | InChI=1S/C17H20F3IN2O/c18-17(19,20)16(24)23(10-11-5-7-22-8-6-11)15-9-14(15)12-1-3-13(21)4-2-12/h1-4,11,14-15,22H,5-10H2/t14-,15?/m1/s1 |
| InChIKey | IFUBVSQLOMFOGA-GICMACPYSA-N |
| XLogP | 3.54 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.26 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|