C28H20N4OS — CID 138723348
2-(4,6-diphenyl-1,3,5-triazin-2-yl)-1-methyl-10H-phenothiazine 5-oxide (PubChem CID 138723348) has the molecular formula C28H20N4OS and a molecular weight of 460.56 g/mol. Its IUPAC name is 2-(4,6-diphenyl-1,3,5-triazin-2-yl)-1-methyl-10H-phenothiazine 5-oxide.
| Compound Name | 2-(4,6-diphenyl-1,3,5-triazin-2-yl)-1-methyl-10H-phenothiazine 5-oxide |
|---|---|
| PubChem CID | 138723348 |
| Molecular Formula | C28H20N4OS |
| Molecular Weight | 460.56 g/mol |
| Exact Mass | 460.14 |
| IUPAC Name | 2-(4,6-diphenyl-1,3,5-triazin-2-yl)-1-methyl-10H-phenothiazine 5-oxide |
| SMILES | Cc1c(-c2nc(-c3ccccc3)nc(-c3ccccc3)n2)ccc2c1Nc1ccccc1S2=O |
| InChI | InChI=1S/C28H20N4OS/c1-18-21(16-17-24-25(18)29-22-14-8-9-15-23(22)34(24)33)28-31-26(19-10-4-2-5-11-19)30-27(32-28)20-12-6-3-7-13-20/h2-17,29H,1H3 |
| InChIKey | ZSHDCZCVGVWISV-UHFFFAOYSA-N |
| XLogP | 6.40 |
| TPSA | 67.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.56 |
| LogP ≤ 5 | 6.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |