C13H10N2OS — CID 11413817
(1S)-3-phenyl-4H-1lambda4,2,4-benzothiadiazine 1-oxide (PubChem CID 11413817) has the molecular formula C13H10N2OS and a molecular weight of 242.30 g/mol. Its IUPAC name is (1S)-3-phenyl-4H-1lambda4,2,4-benzothiadiazine 1-oxide.
| Compound Name | (1S)-3-phenyl-4H-1lambda4,2,4-benzothiadiazine 1-oxide |
|---|---|
| PubChem CID | 11413817 |
| Molecular Formula | C13H10N2OS |
| Molecular Weight | 242.30 g/mol |
| Exact Mass | 242.05 |
| IUPAC Name | (1S)-3-phenyl-4H-1lambda4,2,4-benzothiadiazine 1-oxide |
| SMILES | O=[S@@]1N=C(c2ccccc2)Nc2ccccc21 |
| InChI | InChI=1S/C13H10N2OS/c16-17-12-9-5-4-8-11(12)14-13(15-17)10-6-2-1-3-7-10/h1-9H,(H,14,15)/t17-/m0/s1 |
| InChIKey | QPQKICQXTOOCPK-KRWDZBQOSA-N |
| XLogP | 2.58 |
| TPSA | 41.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.30 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |