C10H8F4N2 — CID 141467271
4,4,6,6-tetrafluoro-2-phenyl-1,5-dihydropyrimidine (PubChem CID 141467271) has the molecular formula C10H8F4N2 and a molecular weight of 232.18 g/mol. Its IUPAC name is 4,4,6,6-tetrafluoro-2-phenyl-1,5-dihydropyrimidine.
| Compound Name | 4,4,6,6-tetrafluoro-2-phenyl-1,5-dihydropyrimidine |
|---|---|
| PubChem CID | 141467271 |
| Molecular Formula | C10H8F4N2 |
| Molecular Weight | 232.18 g/mol |
| Exact Mass | 232.06 |
| IUPAC Name | 4,4,6,6-tetrafluoro-2-phenyl-1,5-dihydropyrimidine |
| SMILES | FC1(F)CC(F)(F)NC(c2ccccc2)=N1 |
| InChI | InChI=1S/C10H8F4N2/c11-9(12)6-10(13,14)16-8(15-9)7-4-2-1-3-5-7/h1-5H,6H2,(H,15,16) |
| InChIKey | MZQLCGUPRLZMJN-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.18 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|