C13H7Cl12N3 — CID 160878276
6-phenyl-2,2,4,4-tetrakis(trichloromethyl)-1,3-dihydro-1,3,5-triazine (PubChem CID 160878276) has the molecular formula C13H7Cl12N3 and a molecular weight of 630.66 g/mol. Its IUPAC name is 6-phenyl-2,2,4,4-tetrakis(trichloromethyl)-1,3-dihydro-1,3,5-triazine.
| Compound Name | 6-phenyl-2,2,4,4-tetrakis(trichloromethyl)-1,3-dihydro-1,3,5-triazine |
|---|---|
| PubChem CID | 160878276 |
| Molecular Formula | C13H7Cl12N3 |
| Molecular Weight | 630.66 g/mol |
| Exact Mass | 624.69 |
| IUPAC Name | 6-phenyl-2,2,4,4-tetrakis(trichloromethyl)-1,3-dihydro-1,3,5-triazine |
| SMILES | ClC(Cl)(Cl)C1(C(Cl)(Cl)Cl)N=C(c2ccccc2)NC(C(Cl)(Cl)Cl)(C(Cl)(Cl)Cl)N1 |
| InChI | InChI=1S/C13H7Cl12N3/c14-10(15,16)8(11(17,18)19)26-7(6-4-2-1-3-5-6)27-9(28-8,12(20,21)22)13(23,24)25/h1-5,28H,(H,26,27) |
| InChIKey | SMRPLQBUUYTDKJ-UHFFFAOYSA-N |
| XLogP | 7.50 |
| TPSA | 36.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 28 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 630.66 |
| LogP ≤ 5 | 7.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|