C9H10N2O — CID 175749846
4-phenyl-3,6-dihydro-2H-1,3,5-oxadiazine (PubChem CID 175749846) has the molecular formula C9H10N2O and a molecular weight of 162.19 g/mol. Its IUPAC name is 4-phenyl-3,6-dihydro-2H-1,3,5-oxadiazine.
| Compound Name | 4-phenyl-3,6-dihydro-2H-1,3,5-oxadiazine |
|---|---|
| PubChem CID | 175749846 |
| Molecular Formula | C9H10N2O |
| Molecular Weight | 162.19 g/mol |
| Exact Mass | 162.08 |
| IUPAC Name | 4-phenyl-3,6-dihydro-2H-1,3,5-oxadiazine |
| SMILES | c1ccc(C2=NCOCN2)cc1 |
| InChI | InChI=1S/C9H10N2O/c1-2-4-8(5-3-1)9-10-6-12-7-11-9/h1-5H,6-7H2,(H,10,11) |
| InChIKey | MZRVDVNKMDHMEY-UHFFFAOYSA-N |
| XLogP | 0.97 |
| TPSA | 33.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 162.19 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |