C20H21Cl2NOS — CID 138728516
N-[2-[[(4S)-4-(3,4-dichlorophenyl)-1,2,3,4-tetrahydronaphthalen-1-yl]methylsulfanyl]ethyl]formamide (PubChem CID 138728516) has the molecular formula C20H21Cl2NOS and a molecular weight of 394.37 g/mol. Its IUPAC name is N-[2-[[(4S)-4-(3,4-dichlorophenyl)-1,2,3,4-tetrahydronaphthalen-1-yl]methylsulfanyl]ethyl]formamide.
| Compound Name | N-[2-[[(4S)-4-(3,4-dichlorophenyl)-1,2,3,4-tetrahydronaphthalen-1-yl]methylsulfanyl]ethyl]formamide |
|---|---|
| PubChem CID | 138728516 |
| Molecular Formula | C20H21Cl2NOS |
| Molecular Weight | 394.37 g/mol |
| Exact Mass | 393.07 |
| IUPAC Name | N-[2-[[(4S)-4-(3,4-dichlorophenyl)-1,2,3,4-tetrahydronaphthalen-1-yl]methylsulfanyl]ethyl]formamide |
| SMILES | O=CNCCSCC1CC[C@@H](c2ccc(Cl)c(Cl)c2)c2ccccc21 |
| InChI | InChI=1S/C20H21Cl2NOS/c21-19-8-6-14(11-20(19)22)17-7-5-15(12-25-10-9-23-13-24)16-3-1-2-4-18(16)17/h1-4,6,8,11,13,15,17H,5,7,9-10,12H2,(H,23,24)/t15?,17-/m0/s1 |
| InChIKey | XSPPYSYYTWBFNF-LWKPJOBUSA-N |
| XLogP | 5.48 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.37 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|