C20H21Cl2NO4 — CID 25000188
butanedioic acid;(1S,4S)-4-(3,4-dichlorophenyl)-1,2,3,4-tetrahydronaphthalen-1-amine (PubChem CID 25000188) has the molecular formula C20H21Cl2NO4 and a molecular weight of 410.30 g/mol. Its IUPAC name is butanedioic acid;(1S,4S)-4-(3,4-dichlorophenyl)-1,2,3,4-tetrahydronaphthalen-1-amine.
| Compound Name | butanedioic acid;(1S,4S)-4-(3,4-dichlorophenyl)-1,2,3,4-tetrahydronaphthalen-1-amine |
|---|---|
| PubChem CID | 25000188 |
| Molecular Formula | C20H21Cl2NO4 |
| Molecular Weight | 410.30 g/mol |
| Exact Mass | 409.08 |
| IUPAC Name | butanedioic acid;(1S,4S)-4-(3,4-dichlorophenyl)-1,2,3,4-tetrahydronaphthalen-1-amine |
| SMILES | N[C@H]1CC[C@@H](c2ccc(Cl)c(Cl)c2)c2ccccc21.O=C(O)CCC(=O)O |
| InChI | InChI=1S/C16H15Cl2N.C4H6O4/c17-14-7-5-10(9-15(14)18)11-6-8-16(19)13-4-2-1-3-12(11)13;5-3(6)1-2-4(7)8/h1-5,7,9,11,16H,6,8,19H2;1-2H2,(H,5,6)(H,7,8)/t11-,16-;/m0./s1 |
| InChIKey | BLTSKJGIMHFHQM-RISSCEEYSA-N |
| XLogP | 4.85 |
| TPSA | 100.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.30 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |