C20H30N4O8 — CID 138730423
2-(2-methoxyethoxy)ethyl N-[1-[(6,7-dioxo-5,8,9,10-tetrahydro-4H-[1,3]oxazolo[5,4-c]azonin-8-yl)amino]-3-methyl-1-oxobutan-2-yl]carbamate (PubChem CID 138730423) has the molecular formula C20H30N4O8 and a molecular weight of 454.48 g/mol. Its IUPAC name is 2-(2-methoxyethoxy)ethyl N-[1-[(6,7-dioxo-5,8,9,10-tetrahydro-4H-[1,3]oxazolo[5,4-c]azonin-8-yl)amino]-3-methyl-1-oxobutan-2-yl]carbamate.
| Compound Name | 2-(2-methoxyethoxy)ethyl N-[1-[(6,7-dioxo-5,8,9,10-tetrahydro-4H-[1,3]oxazolo[5,4-c]azonin-8-yl)amino]-3-methyl-1-oxobutan-2-yl]carbamate |
|---|---|
| PubChem CID | 138730423 |
| Molecular Formula | C20H30N4O8 |
| Molecular Weight | 454.48 g/mol |
| Exact Mass | 454.21 |
| IUPAC Name | 2-(2-methoxyethoxy)ethyl N-[1-[(6,7-dioxo-5,8,9,10-tetrahydro-4H-[1,3]oxazolo[5,4-c]azonin-8-yl)amino]-3-methyl-1-oxobutan-2-yl]carbamate |
| SMILES | COCCOCCOC(=O)NC(C(=O)NC1CCc2ncoc2CNC(=O)C1=O)C(C)C |
| InChI | InChI=1S/C20H30N4O8/c1-12(2)16(24-20(28)31-9-8-30-7-6-29-3)18(26)23-14-5-4-13-15(32-11-22-13)10-21-19(27)17(14)25/h11-12,14,16H,4-10H2,1-3H3,(H,21,27)(H,23,26)(H,24,28) |
| InChIKey | UBZAEEQUNNCZOG-UHFFFAOYSA-N |
| XLogP | -0.30 |
| TPSA | 158.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.48 |
| LogP ≤ 5 | -0.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|