C21H31N5O7 — CID 138731031
2-(2-methoxyethoxy)ethyl N-[1-[(7,8-dioxo-6,9,10,11-tetrahydro-5H-pyrazino[2,3-c]azonin-9-yl)amino]-3-methyl-1-oxobutan-2-yl]carbamate (PubChem CID 138731031) has the molecular formula C21H31N5O7 and a molecular weight of 465.51 g/mol. Its IUPAC name is 2-(2-methoxyethoxy)ethyl N-[1-[(7,8-dioxo-6,9,10,11-tetrahydro-5H-pyrazino[2,3-c]azonin-9-yl)amino]-3-methyl-1-oxobutan-2-yl]carbamate.
| Compound Name | 2-(2-methoxyethoxy)ethyl N-[1-[(7,8-dioxo-6,9,10,11-tetrahydro-5H-pyrazino[2,3-c]azonin-9-yl)amino]-3-methyl-1-oxobutan-2-yl]carbamate |
|---|---|
| PubChem CID | 138731031 |
| Molecular Formula | C21H31N5O7 |
| Molecular Weight | 465.51 g/mol |
| Exact Mass | 465.22 |
| IUPAC Name | 2-(2-methoxyethoxy)ethyl N-[1-[(7,8-dioxo-6,9,10,11-tetrahydro-5H-pyrazino[2,3-c]azonin-9-yl)amino]-3-methyl-1-oxobutan-2-yl]carbamate |
| SMILES | COCCOCCOC(=O)NC(C(=O)NC1CCc2nccnc2CNC(=O)C1=O)C(C)C |
| InChI | InChI=1S/C21H31N5O7/c1-13(2)17(26-21(30)33-11-10-32-9-8-31-3)19(28)25-15-5-4-14-16(23-7-6-22-14)12-24-20(29)18(15)27/h6-7,13,15,17H,4-5,8-12H2,1-3H3,(H,24,29)(H,25,28)(H,26,30) |
| InChIKey | BZHAAAWICZTHMD-UHFFFAOYSA-N |
| XLogP | -0.49 |
| TPSA | 157.84 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.51 |
| LogP ≤ 5 | -0.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|