C27H34N6O4 — CID 138734828
3-[2-(3,5-dimethoxyphenyl)ethynyl]-1-[(3S)-1-prop-2-enoylpyrrolidin-3-yl]-5-(2-pyrrolidin-1-ylethylamino)pyrazole-4-carboxamide (PubChem CID 138734828) has the molecular formula C27H34N6O4 and a molecular weight of 506.61 g/mol. Its IUPAC name is 3-[2-(3,5-dimethoxyphenyl)ethynyl]-1-[(3S)-1-prop-2-enoylpyrrolidin-3-yl]-5-(2-pyrrolidin-1-ylethylamino)pyrazole-4-carboxamide.
| Compound Name | 3-[2-(3,5-dimethoxyphenyl)ethynyl]-1-[(3S)-1-prop-2-enoylpyrrolidin-3-yl]-5-(2-pyrrolidin-1-ylethylamino)pyrazole-4-carboxamide |
|---|---|
| PubChem CID | 138734828 |
| Molecular Formula | C27H34N6O4 |
| Molecular Weight | 506.61 g/mol |
| Exact Mass | 506.26 |
| IUPAC Name | 3-[2-(3,5-dimethoxyphenyl)ethynyl]-1-[(3S)-1-prop-2-enoylpyrrolidin-3-yl]-5-(2-pyrrolidin-1-ylethylamino)pyrazole-4-carboxamide |
| SMILES | C=CC(=O)N1CC[C@H](n2nc(C#Cc3cc(OC)cc(OC)c3)c(C(N)=O)c2NCCN2CCCC2)C1 |
| InChI | InChI=1S/C27H34N6O4/c1-4-24(34)32-13-9-20(18-32)33-27(29-10-14-31-11-5-6-12-31)25(26(28)35)23(30-33)8-7-19-15-21(36-2)17-22(16-19)37-3/h4,15-17,20,29H,1,5-6,9-14,18H2,2-3H3,(H2,28,35)/t20-/m0/s1 |
| InChIKey | HUXAYMWWNBTISC-FQEVSTJZSA-N |
| XLogP | 1.87 |
| TPSA | 114.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.61 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|