C20H21N5O4 — CID 134366110
5-amino-3-[2-(3,5-dimethoxyphenyl)ethynyl]-1-(1-prop-2-enoylazetidin-3-yl)pyrazole-4-carboxamide (PubChem CID 134366110) has the molecular formula C20H21N5O4 and a molecular weight of 395.42 g/mol. Its IUPAC name is 5-amino-3-[2-(3,5-dimethoxyphenyl)ethynyl]-1-(1-prop-2-enoylazetidin-3-yl)pyrazole-4-carboxamide.
| Compound Name | 5-amino-3-[2-(3,5-dimethoxyphenyl)ethynyl]-1-(1-prop-2-enoylazetidin-3-yl)pyrazole-4-carboxamide |
|---|---|
| PubChem CID | 134366110 |
| Molecular Formula | C20H21N5O4 |
| Molecular Weight | 395.42 g/mol |
| Exact Mass | 395.16 |
| IUPAC Name | 5-amino-3-[2-(3,5-dimethoxyphenyl)ethynyl]-1-(1-prop-2-enoylazetidin-3-yl)pyrazole-4-carboxamide |
| SMILES | C=CC(=O)N1CC(n2nc(C#Cc3cc(OC)cc(OC)c3)c(C(N)=O)c2N)C1 |
| InChI | InChI=1S/C20H21N5O4/c1-4-17(26)24-10-13(11-24)25-19(21)18(20(22)27)16(23-25)6-5-12-7-14(28-2)9-15(8-12)29-3/h4,7-9,13H,1,10-11,21H2,2-3H3,(H2,22,27) |
| InChIKey | BTMIUUZBVYPGSO-UHFFFAOYSA-N |
| XLogP | 0.55 |
| TPSA | 125.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.42 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|