C22H25N5O4 — CID 134366070
5-amino-3-[2-(3,5-dimethoxyphenyl)ethynyl]-1-[(1-prop-2-enoylpyrrolidin-3-yl)methyl]pyrazole-4-carboxamide (PubChem CID 134366070) has the molecular formula C22H25N5O4 and a molecular weight of 423.47 g/mol. Its IUPAC name is 5-amino-3-[2-(3,5-dimethoxyphenyl)ethynyl]-1-[(1-prop-2-enoylpyrrolidin-3-yl)methyl]pyrazole-4-carboxamide.
| Compound Name | 5-amino-3-[2-(3,5-dimethoxyphenyl)ethynyl]-1-[(1-prop-2-enoylpyrrolidin-3-yl)methyl]pyrazole-4-carboxamide |
|---|---|
| PubChem CID | 134366070 |
| Molecular Formula | C22H25N5O4 |
| Molecular Weight | 423.47 g/mol |
| Exact Mass | 423.19 |
| IUPAC Name | 5-amino-3-[2-(3,5-dimethoxyphenyl)ethynyl]-1-[(1-prop-2-enoylpyrrolidin-3-yl)methyl]pyrazole-4-carboxamide |
| SMILES | C=CC(=O)N1CCC(Cn2nc(C#Cc3cc(OC)cc(OC)c3)c(C(N)=O)c2N)C1 |
| InChI | InChI=1S/C22H25N5O4/c1-4-19(28)26-8-7-15(12-26)13-27-21(23)20(22(24)29)18(25-27)6-5-14-9-16(30-2)11-17(10-14)31-3/h4,9-11,15H,1,7-8,12-13,23H2,2-3H3,(H2,24,29) |
| InChIKey | FSSSZUYRWRKQTG-UHFFFAOYSA-N |
| XLogP | 1.02 |
| TPSA | 125.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.47 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|