C26H42N2O6 — CID 138735675
5-[[10-(carbamoyloxymethyl)-4,10-dimethyl-4-tricyclo[6.3.1.02,7]dodecanyl]methoxycarbonylamino]pentyl prop-2-enoate (PubChem CID 138735675) has the molecular formula C26H42N2O6 and a molecular weight of 478.63 g/mol. Its IUPAC name is 5-[[10-(carbamoyloxymethyl)-4,10-dimethyl-4-tricyclo[6.3.1.02,7]dodecanyl]methoxycarbonylamino]pentyl prop-2-enoate.
| Compound Name | 5-[[10-(carbamoyloxymethyl)-4,10-dimethyl-4-tricyclo[6.3.1.02,7]dodecanyl]methoxycarbonylamino]pentyl prop-2-enoate |
|---|---|
| PubChem CID | 138735675 |
| Molecular Formula | C26H42N2O6 |
| Molecular Weight | 478.63 g/mol |
| Exact Mass | 478.30 |
| IUPAC Name | 5-[[10-(carbamoyloxymethyl)-4,10-dimethyl-4-tricyclo[6.3.1.02,7]dodecanyl]methoxycarbonylamino]pentyl prop-2-enoate |
| SMILES | C=CC(=O)OCCCCCNC(=O)OCC1(C)CCC2C3CC(CC(C)(COC(N)=O)C3)C2C1 |
| InChI | InChI=1S/C26H42N2O6/c1-4-22(29)32-11-7-5-6-10-28-24(31)34-16-25(2)9-8-20-18-12-19(21(20)15-25)14-26(3,13-18)17-33-23(27)30/h4,18-21H,1,5-17H2,2-3H3,(H2,27,30)(H,28,31) |
| InChIKey | PYHIMZJKHYMZLH-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 116.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.63 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|