C30H46N2O8 — CID 123650160
2-[[4,10-dimethyl-10-[2-(2-methylprop-2-enoyloxy)ethylcarbamoyloxymethyl]-4-tricyclo[6.3.1.02,7]dodecanyl]methoxycarbonylamino]ethyl 2-methylprop-2-enoate (PubChem CID 123650160) has the molecular formula C30H46N2O8 and a molecular weight of 562.70 g/mol. Its IUPAC name is 2-[[4,10-dimethyl-10-[2-(2-methylprop-2-enoyloxy)ethylcarbamoyloxymethyl]-4-tricyclo[6.3.1.02,7]dodecanyl]methoxycarbonylamino]ethyl 2-methylprop-2-enoate.
| Compound Name | 2-[[4,10-dimethyl-10-[2-(2-methylprop-2-enoyloxy)ethylcarbamoyloxymethyl]-4-tricyclo[6.3.1.02,7]dodecanyl]methoxycarbonylamino]ethyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 123650160 |
| Molecular Formula | C30H46N2O8 |
| Molecular Weight | 562.70 g/mol |
| Exact Mass | 562.33 |
| IUPAC Name | 2-[[4,10-dimethyl-10-[2-(2-methylprop-2-enoyloxy)ethylcarbamoyloxymethyl]-4-tricyclo[6.3.1.02,7]dodecanyl]methoxycarbonylamino]ethyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCCNC(=O)OCC1(C)CC2CC(C1)C1CC(C)(COC(=O)NCCOC(=O)C(=C)C)CCC21 |
| InChI | InChI=1S/C30H46N2O8/c1-19(2)25(33)37-11-9-31-27(35)39-17-29(5)8-7-23-21-13-22(24(23)16-29)15-30(6,14-21)18-40-28(36)32-10-12-38-26(34)20(3)4/h21-24H,1,3,7-18H2,2,4-6H3,(H,31,35)(H,32,36) |
| InChIKey | PRNYLCWANWOOCV-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 129.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.70 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|