C32H46N2O8 — CID 159704410
2-(2-bicyclo[2.2.1]hept-5-enylmethoxycarbonylamino)ethyl 2-methylprop-2-enoate;2-[(1,2-dimethyl-2-bicyclo[2.2.1]hept-5-enyl)methoxycarbonylamino]ethyl 2-methylprop-2-enoate (PubChem CID 159704410) has the molecular formula C32H46N2O8 and a molecular weight of 586.73 g/mol. Its IUPAC name is 2-(2-bicyclo[2.2.1]hept-5-enylmethoxycarbonylamino)ethyl 2-methylprop-2-enoate;2-[(1,2-dimethyl-2-bicyclo[2.2.1]hept-5-enyl)methoxycarbonylamino]ethyl 2-methylprop-2-enoate.
| Compound Name | 2-(2-bicyclo[2.2.1]hept-5-enylmethoxycarbonylamino)ethyl 2-methylprop-2-enoate;2-[(1,2-dimethyl-2-bicyclo[2.2.1]hept-5-enyl)methoxycarbonylamino]ethyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 159704410 |
| Molecular Formula | C32H46N2O8 |
| Molecular Weight | 586.73 g/mol |
| Exact Mass | 586.33 |
| IUPAC Name | 2-(2-bicyclo[2.2.1]hept-5-enylmethoxycarbonylamino)ethyl 2-methylprop-2-enoate;2-[(1,2-dimethyl-2-bicyclo[2.2.1]hept-5-enyl)methoxycarbonylamino]ethyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCCNC(=O)OCC1(C)CC2C=CC1(C)C2.C=C(C)C(=O)OCCNC(=O)OCC1CC2C=CC1C2 |
| InChI | InChI=1S/C17H25NO4.C15H21NO4/c1-12(2)14(19)21-8-7-18-15(20)22-11-17(4)10-13-5-6-16(17,3)9-13;1-10(2)14(17)19-6-5-16-15(18)20-9-13-8-11-3-4-12(13)7-11/h5-6,13H,1,7-11H2,2-4H3,(H,18,20);3-4,11-13H,1,5-9H2,2H3,(H,16,18) |
| InChIKey | MYAKJCMCWCPDFY-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 129.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.73 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|