C19H17NO2S — CID 1387376
2-(4-thiomorpholin-4-ylphenyl)indene-1,3-dione (PubChem CID 1387376) has the molecular formula C19H17NO2S and a molecular weight of 323.42 g/mol. Its IUPAC name is 2-(4-thiomorpholin-4-ylphenyl)indene-1,3-dione.
| Compound Name | 2-(4-thiomorpholin-4-ylphenyl)indene-1,3-dione |
|---|---|
| PubChem CID | 1387376 |
| Molecular Formula | C19H17NO2S |
| Molecular Weight | 323.42 g/mol |
| Exact Mass | 323.10 |
| IUPAC Name | 2-(4-thiomorpholin-4-ylphenyl)indene-1,3-dione |
| SMILES | O=C1c2ccccc2C(=O)C1c1ccc(N2CCSCC2)cc1 |
| InChI | InChI=1S/C19H17NO2S/c21-18-15-3-1-2-4-16(15)19(22)17(18)13-5-7-14(8-6-13)20-9-11-23-12-10-20/h1-8,17H,9-12H2 |
| InChIKey | YUHXSEXCBMIITN-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.42 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'keto_keto_beta_A(68)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|