C19H18F2O4P4 — CID 138739372
[3-fluoro-4,5-bis(phosphanyl)phenyl] (3-fluoro-4-methyl-5-phosphanylphenyl) phenyl phosphate (PubChem CID 138739372) has the molecular formula C19H18F2O4P4 and a molecular weight of 472.24 g/mol. Its IUPAC name is [3-fluoro-4,5-bis(phosphanyl)phenyl] (3-fluoro-4-methyl-5-phosphanylphenyl) phenyl phosphate.
| Compound Name | [3-fluoro-4,5-bis(phosphanyl)phenyl] (3-fluoro-4-methyl-5-phosphanylphenyl) phenyl phosphate |
|---|---|
| PubChem CID | 138739372 |
| Molecular Formula | C19H18F2O4P4 |
| Molecular Weight | 472.24 g/mol |
| Exact Mass | 472.01 |
| IUPAC Name | [3-fluoro-4,5-bis(phosphanyl)phenyl] (3-fluoro-4-methyl-5-phosphanylphenyl) phenyl phosphate |
| SMILES | Cc1c(F)cc(OP(=O)(Oc2ccccc2)Oc2cc(F)c(P)c(P)c2)cc1P |
| InChI | InChI=1S/C19H18F2O4P4/c1-11-15(20)7-13(9-17(11)26)24-29(22,23-12-5-3-2-4-6-12)25-14-8-16(21)19(28)18(27)10-14/h2-10H,26-28H2,1H3 |
| InChIKey | MVPIJBJURBEZFO-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.24 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|