C18H25N3O7 — CID 138739507
(2,5-dioxopyrrolidin-1-yl) 6-[3-[methyl-[(Z)-4-oxobut-2-enoyl]amino]propanoylamino]hexanoate (PubChem CID 138739507) has the molecular formula C18H25N3O7 and a molecular weight of 395.41 g/mol. Its IUPAC name is (2,5-dioxopyrrolidin-1-yl) 6-[3-[methyl-[(Z)-4-oxobut-2-enoyl]amino]propanoylamino]hexanoate.
| Compound Name | (2,5-dioxopyrrolidin-1-yl) 6-[3-[methyl-[(Z)-4-oxobut-2-enoyl]amino]propanoylamino]hexanoate |
|---|---|
| PubChem CID | 138739507 |
| Molecular Formula | C18H25N3O7 |
| Molecular Weight | 395.41 g/mol |
| Exact Mass | 395.17 |
| IUPAC Name | (2,5-dioxopyrrolidin-1-yl) 6-[3-[methyl-[(Z)-4-oxobut-2-enoyl]amino]propanoylamino]hexanoate |
| SMILES | CN(CCC(=O)NCCCCCC(=O)ON1C(=O)CCC1=O)C(=O)/C=C\C=O |
| InChI | InChI=1S/C18H25N3O7/c1-20(15(24)6-5-13-22)12-10-14(23)19-11-4-2-3-7-18(27)28-21-16(25)8-9-17(21)26/h5-6,13H,2-4,7-12H2,1H3,(H,19,23)/b6-5- |
| InChIKey | WIOFLSWFMALNKU-WAYWQWQTSA-N |
| XLogP | -0.13 |
| TPSA | 130.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.41 |
| LogP ≤ 5 | -0.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|