C27H39N3O3 — CID 138741032
[4-[bis(2-methylpropyl)amino]-3-[(2-methylphenyl)carbamoylamino]phenyl] pentanoate (PubChem CID 138741032) has the molecular formula C27H39N3O3 and a molecular weight of 453.63 g/mol. Its IUPAC name is [4-[bis(2-methylpropyl)amino]-3-[(2-methylphenyl)carbamoylamino]phenyl] pentanoate.
| Compound Name | [4-[bis(2-methylpropyl)amino]-3-[(2-methylphenyl)carbamoylamino]phenyl] pentanoate |
|---|---|
| PubChem CID | 138741032 |
| Molecular Formula | C27H39N3O3 |
| Molecular Weight | 453.63 g/mol |
| Exact Mass | 453.30 |
| IUPAC Name | [4-[bis(2-methylpropyl)amino]-3-[(2-methylphenyl)carbamoylamino]phenyl] pentanoate |
| SMILES | CCCCC(=O)Oc1ccc(N(CC(C)C)CC(C)C)c(NC(=O)Nc2ccccc2C)c1 |
| InChI | InChI=1S/C27H39N3O3/c1-7-8-13-26(31)33-22-14-15-25(30(17-19(2)3)18-20(4)5)24(16-22)29-27(32)28-23-12-10-9-11-21(23)6/h9-12,14-16,19-20H,7-8,13,17-18H2,1-6H3,(H2,28,29,32) |
| InChIKey | GYIUXRAZOYXBEG-UHFFFAOYSA-N |
| XLogP | 6.85 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.63 |
| LogP ≤ 5 | 6.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|