C21H27N3O3 — CID 138751819
6-(2,5-dioxopyrrol-1-yl)-N-[(E)-1-(4-propan-2-ylphenyl)ethylideneamino]hexanamide (PubChem CID 138751819) has the molecular formula C21H27N3O3 and a molecular weight of 369.47 g/mol. Its IUPAC name is 6-(2,5-dioxopyrrol-1-yl)-N-[(E)-1-(4-propan-2-ylphenyl)ethylideneamino]hexanamide.
| Compound Name | 6-(2,5-dioxopyrrol-1-yl)-N-[(E)-1-(4-propan-2-ylphenyl)ethylideneamino]hexanamide |
|---|---|
| PubChem CID | 138751819 |
| Molecular Formula | C21H27N3O3 |
| Molecular Weight | 369.47 g/mol |
| Exact Mass | 369.21 |
| IUPAC Name | 6-(2,5-dioxopyrrol-1-yl)-N-[(E)-1-(4-propan-2-ylphenyl)ethylideneamino]hexanamide |
| SMILES | C/C(=N\NC(=O)CCCCCN1C(=O)C=CC1=O)c1ccc(C(C)C)cc1 |
| InChI | InChI=1S/C21H27N3O3/c1-15(2)17-8-10-18(11-9-17)16(3)22-23-19(25)7-5-4-6-14-24-20(26)12-13-21(24)27/h8-13,15H,4-7,14H2,1-3H3,(H,23,25)/b22-16+ |
| InChIKey | XGQHPAHOISYFSM-CJLVFECKSA-N |
| XLogP | 3.14 |
| TPSA | 78.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.47 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|