C23H33Cl2N6O7P — CID 144985617
diaminomethyl acetate;dichloromethane;phosphanyl N-[4-[(E)-N-[6-(2,5-dioxopyrrol-1-yl)hexanoylamino]-C-methylcarbonimidoyl]phenyl]carbamate (PubChem CID 144985617) has the molecular formula C23H33Cl2N6O7P and a molecular weight of 607.43 g/mol. Its IUPAC name is diaminomethyl acetate;dichloromethane;phosphanyl N-[4-[(E)-N-[6-(2,5-dioxopyrrol-1-yl)hexanoylamino]-C-methylcarbonimidoyl]phenyl]carbamate.
| Compound Name | diaminomethyl acetate;dichloromethane;phosphanyl N-[4-[(E)-N-[6-(2,5-dioxopyrrol-1-yl)hexanoylamino]-C-methylcarbonimidoyl]phenyl]carbamate |
|---|---|
| PubChem CID | 144985617 |
| Molecular Formula | C23H33Cl2N6O7P |
| Molecular Weight | 607.43 g/mol |
| Exact Mass | 606.15 |
| IUPAC Name | diaminomethyl acetate;dichloromethane;phosphanyl N-[4-[(E)-N-[6-(2,5-dioxopyrrol-1-yl)hexanoylamino]-C-methylcarbonimidoyl]phenyl]carbamate |
| SMILES | C/C(=N\NC(=O)CCCCCN1C(=O)C=CC1=O)c1ccc(NC(=O)OP)cc1.CC(=O)OC(N)N.ClCCl |
| InChI | InChI=1S/C19H23N4O5P.C3H8N2O2.CH2Cl2/c1-13(14-6-8-15(9-7-14)20-19(27)28-29)21-22-16(24)5-3-2-4-12-23-17(25)10-11-18(23)26;1-2(6)7-3(4)5;2-1-3/h6-11H,2-5,12,29H2,1H3,(H,20,27)(H,22,24);3H,4-5H2,1H3;1H2/b21-13+;; |
| InChIKey | RAQBANBLOSSJHN-ORKRDPRMSA-N |
| XLogP | 2.52 |
| TPSA | 195.51 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 607.43 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|