C22H20Cl2N4O5 — CID 138752923
3-[(2,3-dichlorophenyl)methyl]-2,4-dioxo-1-[4-(2-oxo-1,3-diazinan-1-yl)phenyl]-1,3-diazinane-5-carboxylic acid (PubChem CID 138752923) has the molecular formula C22H20Cl2N4O5 and a molecular weight of 491.33 g/mol. Its IUPAC name is 3-[(2,3-dichlorophenyl)methyl]-2,4-dioxo-1-[4-(2-oxo-1,3-diazinan-1-yl)phenyl]-1,3-diazinane-5-carboxylic acid.
| Compound Name | 3-[(2,3-dichlorophenyl)methyl]-2,4-dioxo-1-[4-(2-oxo-1,3-diazinan-1-yl)phenyl]-1,3-diazinane-5-carboxylic acid |
|---|---|
| PubChem CID | 138752923 |
| Molecular Formula | C22H20Cl2N4O5 |
| Molecular Weight | 491.33 g/mol |
| Exact Mass | 490.08 |
| IUPAC Name | 3-[(2,3-dichlorophenyl)methyl]-2,4-dioxo-1-[4-(2-oxo-1,3-diazinan-1-yl)phenyl]-1,3-diazinane-5-carboxylic acid |
| SMILES | O=C(O)C1CN(c2ccc(N3CCCNC3=O)cc2)C(=O)N(Cc2cccc(Cl)c2Cl)C1=O |
| InChI | InChI=1S/C22H20Cl2N4O5/c23-17-4-1-3-13(18(17)24)11-28-19(29)16(20(30)31)12-27(22(28)33)15-7-5-14(6-8-15)26-10-2-9-25-21(26)32/h1,3-8,16H,2,9-12H2,(H,25,32)(H,30,31) |
| InChIKey | VUSMUSXBVQIEET-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 110.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.33 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|