C7H8O5 — CID 138756296
(4R,7R)-4,7-dihydroxy-4,5,7,7a-tetrahydrofuro[2,3-c]pyran-2-one (PubChem CID 138756296) has the molecular formula C7H8O5 and a molecular weight of 172.14 g/mol. Its IUPAC name is (4R,7R)-4,7-dihydroxy-4,5,7,7a-tetrahydrofuro[2,3-c]pyran-2-one.
| Compound Name | (4R,7R)-4,7-dihydroxy-4,5,7,7a-tetrahydrofuro[2,3-c]pyran-2-one |
|---|---|
| PubChem CID | 138756296 |
| Molecular Formula | C7H8O5 |
| Molecular Weight | 172.14 g/mol |
| Exact Mass | 172.04 |
| IUPAC Name | (4R,7R)-4,7-dihydroxy-4,5,7,7a-tetrahydrofuro[2,3-c]pyran-2-one |
| SMILES | O=C1C=C2C(O1)[C@H](O)OC[C@@H]2O |
| InChI | InChI=1S/C7H8O5/c8-4-2-11-7(10)6-3(4)1-5(9)12-6/h1,4,6-8,10H,2H2/t4-,6?,7+/m0/s1 |
| InChIKey | RUJWBBAVRBNHNV-WTRRFROCSA-N |
| XLogP | -1.45 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 172.14 |
| LogP ≤ 5 | -1.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |