C7H10O5 — CID 10654808
3-[(1R,2R)-1,2,3-trihydroxypropyl]-2H-furan-5-one (PubChem CID 10654808) has the molecular formula C7H10O5 and a molecular weight of 174.15 g/mol. Its IUPAC name is 3-[(1R,2R)-1,2,3-trihydroxypropyl]-2H-furan-5-one.
| Compound Name | 3-[(1R,2R)-1,2,3-trihydroxypropyl]-2H-furan-5-one |
|---|---|
| PubChem CID | 10654808 |
| Molecular Formula | C7H10O5 |
| Molecular Weight | 174.15 g/mol |
| Exact Mass | 174.05 |
| IUPAC Name | 3-[(1R,2R)-1,2,3-trihydroxypropyl]-2H-furan-5-one |
| SMILES | O=C1C=C([C@@H](O)[C@H](O)CO)CO1 |
| InChI | InChI=1S/C7H10O5/c8-2-5(9)7(11)4-1-6(10)12-3-4/h1,5,7-9,11H,2-3H2/t5-,7-/m1/s1 |
| InChIKey | HGSNSVPUPKRBBJ-IYSWYEEDSA-N |
| XLogP | -1.82 |
| TPSA | 86.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 174.15 |
| LogP ≤ 5 | -1.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |