C9H14O4 — CID 134856184
2-(1,4-dihydroxybutyl)-4-methyl-2H-furan-5-one (PubChem CID 134856184) has the molecular formula C9H14O4 and a molecular weight of 186.21 g/mol. Its IUPAC name is 2-(1,4-dihydroxybutyl)-4-methyl-2H-furan-5-one.
| Compound Name | 2-(1,4-dihydroxybutyl)-4-methyl-2H-furan-5-one |
|---|---|
| PubChem CID | 134856184 |
| Molecular Formula | C9H14O4 |
| Molecular Weight | 186.21 g/mol |
| Exact Mass | 186.09 |
| IUPAC Name | 2-(1,4-dihydroxybutyl)-4-methyl-2H-furan-5-one |
| SMILES | CC1=CC(C(O)CCCO)OC1=O |
| InChI | InChI=1S/C9H14O4/c1-6-5-8(13-9(6)12)7(11)3-2-4-10/h5,7-8,10-11H,2-4H2,1H3 |
| InChIKey | XSBOMKOVGBPJNV-UHFFFAOYSA-N |
| XLogP | -0.01 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.21 |
| LogP ≤ 5 | -0.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |