C18H22O4 — CID 138756430
(3Z)-4-benzylidene-3-[hydroxy(methoxy)methylidene]-5,5,6,6-tetramethyloxan-2-one (PubChem CID 138756430) has the molecular formula C18H22O4 and a molecular weight of 302.37 g/mol. Its IUPAC name is (3Z)-4-benzylidene-3-[hydroxy(methoxy)methylidene]-5,5,6,6-tetramethyloxan-2-one.
| Compound Name | (3Z)-4-benzylidene-3-[hydroxy(methoxy)methylidene]-5,5,6,6-tetramethyloxan-2-one |
|---|---|
| PubChem CID | 138756430 |
| Molecular Formula | C18H22O4 |
| Molecular Weight | 302.37 g/mol |
| Exact Mass | 302.15 |
| IUPAC Name | (3Z)-4-benzylidene-3-[hydroxy(methoxy)methylidene]-5,5,6,6-tetramethyloxan-2-one |
| SMILES | CO/C(O)=C1\C(=O)OC(C)(C)C(C)(C)C1=Cc1ccccc1 |
| InChI | InChI=1S/C18H22O4/c1-17(2)13(11-12-9-7-6-8-10-12)14(15(19)21-5)16(20)22-18(17,3)4/h6-11,19H,1-5H3/b13-11?,15-14- |
| InChIKey | YONDGEWRCFUASK-QSTOHMKHSA-N |
| XLogP | 3.85 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.37 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|