About (3E)-4,4-dimethyl-3-[(4-phenylphenyl)methylidene]oxolan-2-one
(3E)-4,4-dimethyl-3-[(4-phenylphenyl)methylidene]oxolan-2-one (PubChem CID 155683447) has the molecular formula C19H18O2
and a molecular weight of 278.35 g/mol. Its IUPAC name is (3E)-4,4-dimethyl-3-[(4-phenylphenyl)methylidene]oxolan-2-one.
Molecular Properties
| Compound Name | (3E)-4,4-dimethyl-3-[(4-phenylphenyl)methylidene]oxolan-2-one |
| PubChem CID | 155683447 |
| Molecular Formula | C19H18O2 |
| Molecular Weight | 278.35 g/mol |
| Exact Mass | 278.13 |
| IUPAC Name | (3E)-4,4-dimethyl-3-[(4-phenylphenyl)methylidene]oxolan-2-one |
| SMILES | CC1(C)COC(=O)/C1=C/c1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C19H18O2/c1-19(2)13-21-18(20)17(19)12-14-8-10-16(11-9-14)15-6-4-3-5-7-15/h3-12H,13H2,1-2H3/b17-12- |
| InChIKey | RMCXDBIAJAQOMN-ATVHPVEESA-N |
| XLogP | 4.32 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 278.35 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze (3E)-4,4-dimethyl-3-[(4-phenylphenyl)methylidene]oxolan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3E)-4,4-dimethyl-3-[(4-phenylphenyl)methylidene]oxolan-2-one?
The IUPAC name of (3E)-4,4-dimethyl-3-[(4-phenylphenyl)methylidene]oxolan-2-one (CID 155683447) is (3E)-4,4-dimethyl-3-[(4-phenylphenyl)methylidene]oxolan-2-one.
What is the SMILES notation for (3E)-4,4-dimethyl-3-[(4-phenylphenyl)methylidene]oxolan-2-one?
The canonical SMILES for (3E)-4,4-dimethyl-3-[(4-phenylphenyl)methylidene]oxolan-2-one is CC1(C)COC(=O)/C1=C/c1ccc(-c2ccccc2)cc1.
What is the InChIKey of (3E)-4,4-dimethyl-3-[(4-phenylphenyl)methylidene]oxolan-2-one?
The InChIKey is RMCXDBIAJAQOMN-ATVHPVEESA-N. The full InChI is InChI=1S/C19H18O2/c1-19(2)13-21-18(20)17(19)12-14-8-10-16(11-9-14)15-6-4-3-5-7-15/h3-12H,13H2,1-2H3/b17-12-.
What are the key properties of (3E)-4,4-dimethyl-3-[(4-phenylphenyl)methylidene]oxolan-2-one?
(3E)-4,4-dimethyl-3-[(4-phenylphenyl)methylidene]oxolan-2-one has a molecular weight of 278.35 g/mol, XLogP of 4.32, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (3E)-4,4-dimethyl-3-[(4-phenylphenyl)methylidene]oxolan-2-one is sourced from PubChem (CID 155683447), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).