C30H25Cl2NO — CID 139214370
(6Z)-2-(4-chlorophenyl)-6-[(4-chlorophenyl)methylidene]-7,7-dimethyl-4-phenyl-4,8-dihydro-1H-quinolin-5-one (PubChem CID 139214370) has the molecular formula C30H25Cl2NO and a molecular weight of 486.44 g/mol. Its IUPAC name is (6Z)-2-(4-chlorophenyl)-6-[(4-chlorophenyl)methylidene]-7,7-dimethyl-4-phenyl-4,8-dihydro-1H-quinolin-5-one.
| Compound Name | (6Z)-2-(4-chlorophenyl)-6-[(4-chlorophenyl)methylidene]-7,7-dimethyl-4-phenyl-4,8-dihydro-1H-quinolin-5-one |
|---|---|
| PubChem CID | 139214370 |
| Molecular Formula | C30H25Cl2NO |
| Molecular Weight | 486.44 g/mol |
| Exact Mass | 485.13 |
| IUPAC Name | (6Z)-2-(4-chlorophenyl)-6-[(4-chlorophenyl)methylidene]-7,7-dimethyl-4-phenyl-4,8-dihydro-1H-quinolin-5-one |
| SMILES | CC1(C)CC2=C(C(=O)/C1=C\c1ccc(Cl)cc1)C(c1ccccc1)C=C(c1ccc(Cl)cc1)N2 |
| InChI | InChI=1S/C30H25Cl2NO/c1-30(2)18-27-28(29(34)25(30)16-19-8-12-22(31)13-9-19)24(20-6-4-3-5-7-20)17-26(33-27)21-10-14-23(32)15-11-21/h3-17,24,33H,18H2,1-2H3/b25-16+ |
| InChIKey | XNXRVADQUMVQPW-PCLIKHOPSA-N |
| XLogP | 8.06 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.44 |
| LogP ≤ 5 | 8.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|