C16H12ClNS2 — CID 3275490
4-(4-chlorophenyl)-6-phenyl-3,6-dihydro-1,3-thiazine-2-thione (PubChem CID 3275490) has the molecular formula C16H12ClNS2 and a molecular weight of 317.87 g/mol. Its IUPAC name is 4-(4-chlorophenyl)-6-phenyl-3,6-dihydro-1,3-thiazine-2-thione.
| Compound Name | 4-(4-chlorophenyl)-6-phenyl-3,6-dihydro-1,3-thiazine-2-thione |
|---|---|
| PubChem CID | 3275490 |
| Molecular Formula | C16H12ClNS2 |
| Molecular Weight | 317.87 g/mol |
| Exact Mass | 317.01 |
| IUPAC Name | 4-(4-chlorophenyl)-6-phenyl-3,6-dihydro-1,3-thiazine-2-thione |
| SMILES | S=C1NC(c2ccc(Cl)cc2)=CC(c2ccccc2)S1 |
| InChI | InChI=1S/C16H12ClNS2/c17-13-8-6-11(7-9-13)14-10-15(20-16(19)18-14)12-4-2-1-3-5-12/h1-10,15H,(H,18,19) |
| InChIKey | GWUDDDPKJCOCDC-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.87 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'thio_carbam_ene(2)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|