C39H44N8O5 — CID 138807003
(7R,10S)-14-benzoyl-10-ethyl-7-(1H-indol-3-ylmethyl)-25-methyl-1,5,8,11,14,18,24-heptazatricyclo[18.5.2.023,26]heptacosa-20(27),21,23(26),24-tetraene-6,9,12,19-tetrone (PubChem CID 138807003) has the molecular formula C39H44N8O5 and a molecular weight of 704.83 g/mol. Its IUPAC name is (7R,10S)-14-benzoyl-10-ethyl-7-(1H-indol-3-ylmethyl)-25-methyl-1,5,8,11,14,18,24-heptazatricyclo[18.5.2.023,26]heptacosa-20(27),21,23(26),24-tetraene-6,9,12,19-tetrone.
| Compound Name | (7R,10S)-14-benzoyl-10-ethyl-7-(1H-indol-3-ylmethyl)-25-methyl-1,5,8,11,14,18,24-heptazatricyclo[18.5.2.023,26]heptacosa-20(27),21,23(26),24-tetraene-6,9,12,19-tetrone |
|---|---|
| PubChem CID | 138807003 |
| Molecular Formula | C39H44N8O5 |
| Molecular Weight | 704.83 g/mol |
| Exact Mass | 704.34 |
| IUPAC Name | (7R,10S)-14-benzoyl-10-ethyl-7-(1H-indol-3-ylmethyl)-25-methyl-1,5,8,11,14,18,24-heptazatricyclo[18.5.2.023,26]heptacosa-20(27),21,23(26),24-tetraene-6,9,12,19-tetrone |
| SMILES | CC[C@@H]1NC(=O)CN(C(=O)c2ccccc2)CCCNC(=O)c2ccc3nc(C)n(c3c2)CCCNC(=O)[C@@H](Cc2c[nH]c3ccccc23)NC1=O |
| InChI | InChI=1S/C39H44N8O5/c1-3-30-38(51)45-33(21-28-23-42-31-14-8-7-13-29(28)31)37(50)41-18-10-20-47-25(2)43-32-16-15-27(22-34(32)47)36(49)40-17-9-19-46(24-35(48)44-30)39(52)26-11-5-4-6-12-26/h4-8,11-16,22-23,30,33,42H,3,9-10,17-21,24H2,1-2H3,(H,40,49)(H,41,50)(H,44,48)(H,45,51)/t30-,33+/m0/s1 |
| InChIKey | OEYDTYJJYWUGEG-BZKUTMRRSA-N |
| XLogP | 3.23 |
| TPSA | 170.32 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 52 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 704.83 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |