C34H37N9O4 — CID 154822025
(15S)-15-(1H-indol-3-ylmethyl)-8-(1-methylindazole-3-carbonyl)-2,5,8,13,16,22-hexazabicyclo[16.3.1]docosa-1(21),18(22),19-triene-6,14,17-trione (PubChem CID 154822025) has the molecular formula C34H37N9O4 and a molecular weight of 635.73 g/mol. Its IUPAC name is (15S)-15-(1H-indol-3-ylmethyl)-8-(1-methylindazole-3-carbonyl)-2,5,8,13,16,22-hexazabicyclo[16.3.1]docosa-1(21),18(22),19-triene-6,14,17-trione.
| Compound Name | (15S)-15-(1H-indol-3-ylmethyl)-8-(1-methylindazole-3-carbonyl)-2,5,8,13,16,22-hexazabicyclo[16.3.1]docosa-1(21),18(22),19-triene-6,14,17-trione |
|---|---|
| PubChem CID | 154822025 |
| Molecular Formula | C34H37N9O4 |
| Molecular Weight | 635.73 g/mol |
| Exact Mass | 635.30 |
| IUPAC Name | (15S)-15-(1H-indol-3-ylmethyl)-8-(1-methylindazole-3-carbonyl)-2,5,8,13,16,22-hexazabicyclo[16.3.1]docosa-1(21),18(22),19-triene-6,14,17-trione |
| SMILES | Cn1nc(C(=O)N2CCCCNC(=O)[C@H](Cc3c[nH]c4ccccc34)NC(=O)c3cccc(n3)NCCNC(=O)C2)c2ccccc21 |
| InChI | InChI=1S/C34H37N9O4/c1-42-28-13-5-3-10-24(28)31(41-42)34(47)43-18-7-6-15-37-32(45)27(19-22-20-38-25-11-4-2-9-23(22)25)40-33(46)26-12-8-14-29(39-26)35-16-17-36-30(44)21-43/h2-5,8-14,20,27,38H,6-7,15-19,21H2,1H3,(H,35,39)(H,36,44)(H,37,45)(H,40,46)/t27-/m0/s1 |
| InChIKey | UAYUEKUWGQUHAW-MHZLTWQESA-N |
| XLogP | 2.37 |
| TPSA | 166.14 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 47 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 635.73 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |