C34H37N9O5 — CID 154822254
(15S)-8-[5-(imidazol-1-ylmethyl)furan-2-carbonyl]-15-(1H-indol-3-ylmethyl)-2,5,8,13,16,22-hexazabicyclo[16.3.1]docosa-1(21),18(22),19-triene-6,14,17-trione (PubChem CID 154822254) has the molecular formula C34H37N9O5 and a molecular weight of 651.73 g/mol. Its IUPAC name is (15S)-8-[5-(imidazol-1-ylmethyl)furan-2-carbonyl]-15-(1H-indol-3-ylmethyl)-2,5,8,13,16,22-hexazabicyclo[16.3.1]docosa-1(21),18(22),19-triene-6,14,17-trione.
| Compound Name | (15S)-8-[5-(imidazol-1-ylmethyl)furan-2-carbonyl]-15-(1H-indol-3-ylmethyl)-2,5,8,13,16,22-hexazabicyclo[16.3.1]docosa-1(21),18(22),19-triene-6,14,17-trione |
|---|---|
| PubChem CID | 154822254 |
| Molecular Formula | C34H37N9O5 |
| Molecular Weight | 651.73 g/mol |
| Exact Mass | 651.29 |
| IUPAC Name | (15S)-8-[5-(imidazol-1-ylmethyl)furan-2-carbonyl]-15-(1H-indol-3-ylmethyl)-2,5,8,13,16,22-hexazabicyclo[16.3.1]docosa-1(21),18(22),19-triene-6,14,17-trione |
| SMILES | O=C1CN(C(=O)c2ccc(Cn3ccnc3)o2)CCCCNC(=O)[C@H](Cc2c[nH]c3ccccc23)NC(=O)c2cccc(n2)NCCN1 |
| InChI | InChI=1S/C34H37N9O5/c44-31-21-43(34(47)29-11-10-24(48-29)20-42-17-15-35-22-42)16-4-3-12-38-32(45)28(18-23-19-39-26-7-2-1-6-25(23)26)41-33(46)27-8-5-9-30(40-27)36-13-14-37-31/h1-2,5-11,15,17,19,22,28,39H,3-4,12-14,16,18,20-21H2,(H,36,40)(H,37,44)(H,38,45)(H,41,46)/t28-/m0/s1 |
| InChIKey | TUHNPBWWPMRUHR-NDEPHWFRSA-N |
| XLogP | 2.32 |
| TPSA | 179.28 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 48 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 651.73 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |