C25H22N6O — CID 138858366
(2E,5E)-2,5-bis[[1-(4-methylphenyl)triazol-4-yl]methylidene]cyclopentan-1-one (PubChem CID 138858366) has the molecular formula C25H22N6O and a molecular weight of 422.49 g/mol. Its IUPAC name is (2E,5E)-2,5-bis[[1-(4-methylphenyl)triazol-4-yl]methylidene]cyclopentan-1-one.
| Compound Name | (2E,5E)-2,5-bis[[1-(4-methylphenyl)triazol-4-yl]methylidene]cyclopentan-1-one |
|---|---|
| PubChem CID | 138858366 |
| Molecular Formula | C25H22N6O |
| Molecular Weight | 422.49 g/mol |
| Exact Mass | 422.19 |
| IUPAC Name | (2E,5E)-2,5-bis[[1-(4-methylphenyl)triazol-4-yl]methylidene]cyclopentan-1-one |
| SMILES | Cc1ccc(-n2cc(/C=C3\CC/C(=C\c4cn(-c5ccc(C)cc5)nn4)C3=O)nn2)cc1 |
| InChI | InChI=1S/C25H22N6O/c1-17-3-9-23(10-4-17)30-15-21(26-28-30)13-19-7-8-20(25(19)32)14-22-16-31(29-27-22)24-11-5-18(2)6-12-24/h3-6,9-16H,7-8H2,1-2H3/b19-13+,20-14+ |
| InChIKey | YLWSOMZGXRXYTI-IWGRKNQJSA-N |
| XLogP | 4.29 |
| TPSA | 78.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.49 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_one_ene_A(57)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|