C26H24N6O3 — CID 138858401
(2E,6E)-2,6-bis[[1-(4-methoxyphenyl)triazol-4-yl]methylidene]cyclohexan-1-one (PubChem CID 138858401) has the molecular formula C26H24N6O3 and a molecular weight of 468.52 g/mol. Its IUPAC name is (2E,6E)-2,6-bis[[1-(4-methoxyphenyl)triazol-4-yl]methylidene]cyclohexan-1-one.
| Compound Name | (2E,6E)-2,6-bis[[1-(4-methoxyphenyl)triazol-4-yl]methylidene]cyclohexan-1-one |
|---|---|
| PubChem CID | 138858401 |
| Molecular Formula | C26H24N6O3 |
| Molecular Weight | 468.52 g/mol |
| Exact Mass | 468.19 |
| IUPAC Name | (2E,6E)-2,6-bis[[1-(4-methoxyphenyl)triazol-4-yl]methylidene]cyclohexan-1-one |
| SMILES | COc1ccc(-n2cc(/C=C3\CCC/C(=C\c4cn(-c5ccc(OC)cc5)nn4)C3=O)nn2)cc1 |
| InChI | InChI=1S/C26H24N6O3/c1-34-24-10-6-22(7-11-24)31-16-20(27-29-31)14-18-4-3-5-19(26(18)33)15-21-17-32(30-28-21)23-8-12-25(35-2)13-9-23/h6-17H,3-5H2,1-2H3/b18-14+,19-15+ |
| InChIKey | SFXLLMKSRLJRJO-JSAVKQRWSA-N |
| XLogP | 4.09 |
| TPSA | 96.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.52 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'ene_one_ene_A(57)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|