C23H28BrNO3 — CID 138959357
1-[2-(4-bromophenyl)-3-methylmorpholin-4-yl]-3-(2-prop-2-enylphenoxy)propan-2-ol (PubChem CID 138959357) has the molecular formula C23H28BrNO3 and a molecular weight of 446.39 g/mol. Its IUPAC name is 1-[2-(4-bromophenyl)-3-methylmorpholin-4-yl]-3-(2-prop-2-enylphenoxy)propan-2-ol.
| Compound Name | 1-[2-(4-bromophenyl)-3-methylmorpholin-4-yl]-3-(2-prop-2-enylphenoxy)propan-2-ol |
|---|---|
| PubChem CID | 138959357 |
| Molecular Formula | C23H28BrNO3 |
| Molecular Weight | 446.39 g/mol |
| Exact Mass | 445.13 |
| IUPAC Name | 1-[2-(4-bromophenyl)-3-methylmorpholin-4-yl]-3-(2-prop-2-enylphenoxy)propan-2-ol |
| SMILES | C=CCc1ccccc1OCC(O)CN1CCOC(c2ccc(Br)cc2)C1C |
| InChI | InChI=1S/C23H28BrNO3/c1-3-6-18-7-4-5-8-22(18)28-16-21(26)15-25-13-14-27-23(17(25)2)19-9-11-20(24)12-10-19/h3-5,7-12,17,21,23,26H,1,6,13-16H2,2H3 |
| InChIKey | NGPQYOKNDVWUMC-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 41.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.39 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|