About (3Z,4Z)-3-(cyclopenta-1,3-dien-1-ylmethylidene)-4-inden-1-ylideneoxolane
(3Z,4Z)-3-(cyclopenta-1,3-dien-1-ylmethylidene)-4-inden-1-ylideneoxolane (PubChem CID 138962215) has the molecular formula C19H15O-
and a molecular weight of 259.33 g/mol. Its IUPAC name is (3Z,4Z)-3-(cyclopenta-1,3-dien-1-ylmethylidene)-4-inden-1-ylideneoxolane.
Molecular Properties
| Compound Name | (3Z,4Z)-3-(cyclopenta-1,3-dien-1-ylmethylidene)-4-inden-1-ylideneoxolane |
| PubChem CID | 138962215 |
| Molecular Formula | C19H15O- |
| Molecular Weight | 259.33 g/mol |
| Exact Mass | 259.11 |
| IUPAC Name | (3Z,4Z)-3-(cyclopenta-1,3-dien-1-ylmethylidene)-4-inden-1-ylideneoxolane |
| SMILES | C1=Cc2ccccc2/C1=C1\COC\C1=C/c1ccc[cH-]1 |
| InChI | InChI=1S/C19H15O/c1-2-6-14(5-1)11-16-12-20-13-19(16)18-10-9-15-7-3-4-8-17(15)18/h1-11H,12-13H2/q-1/b16-11+,19-18+ |
| InChIKey | WBBIRKVTQIGESK-FLXQFUDPSA-N |
| XLogP | 4.30 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 259.33 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze (3Z,4Z)-3-(cyclopenta-1,3-dien-1-ylmethylidene)-4-inden-1-ylideneoxolane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3Z,4Z)-3-(cyclopenta-1,3-dien-1-ylmethylidene)-4-inden-1-ylideneoxolane?
The IUPAC name of (3Z,4Z)-3-(cyclopenta-1,3-dien-1-ylmethylidene)-4-inden-1-ylideneoxolane (CID 138962215) is (3Z,4Z)-3-(cyclopenta-1,3-dien-1-ylmethylidene)-4-inden-1-ylideneoxolane.
What is the SMILES notation for (3Z,4Z)-3-(cyclopenta-1,3-dien-1-ylmethylidene)-4-inden-1-ylideneoxolane?
The canonical SMILES for (3Z,4Z)-3-(cyclopenta-1,3-dien-1-ylmethylidene)-4-inden-1-ylideneoxolane is C1=Cc2ccccc2/C1=C1\COC\C1=C/c1ccc[cH-]1.
What is the InChIKey of (3Z,4Z)-3-(cyclopenta-1,3-dien-1-ylmethylidene)-4-inden-1-ylideneoxolane?
The InChIKey is WBBIRKVTQIGESK-FLXQFUDPSA-N. The full InChI is InChI=1S/C19H15O/c1-2-6-14(5-1)11-16-12-20-13-19(16)18-10-9-15-7-3-4-8-17(15)18/h1-11H,12-13H2/q-1/b16-11+,19-18+.
What are the key properties of (3Z,4Z)-3-(cyclopenta-1,3-dien-1-ylmethylidene)-4-inden-1-ylideneoxolane?
(3Z,4Z)-3-(cyclopenta-1,3-dien-1-ylmethylidene)-4-inden-1-ylideneoxolane has a molecular weight of 259.33 g/mol, XLogP of 4.30, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (3Z,4Z)-3-(cyclopenta-1,3-dien-1-ylmethylidene)-4-inden-1-ylideneoxolane is sourced from PubChem (CID 138962215), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).