C19H15O- — CID 138962215
(3Z,4Z)-3-(cyclopenta-1,3-dien-1-ylmethylidene)-4-inden-1-ylideneoxolane (PubChem CID 138962215) has the molecular formula C19H15O- and a molecular weight of 259.33 g/mol. Its IUPAC name is (3Z,4Z)-3-(cyclopenta-1,3-dien-1-ylmethylidene)-4-inden-1-ylideneoxolane.
| Compound Name | (3Z,4Z)-3-(cyclopenta-1,3-dien-1-ylmethylidene)-4-inden-1-ylideneoxolane |
|---|---|
| PubChem CID | 138962215 |
| Molecular Formula | C19H15O- |
| Molecular Weight | 259.33 g/mol |
| Exact Mass | 259.11 |
| IUPAC Name | (3Z,4Z)-3-(cyclopenta-1,3-dien-1-ylmethylidene)-4-inden-1-ylideneoxolane |
| SMILES | C1=Cc2ccccc2/C1=C1\COC\C1=C/c1ccc[cH-]1 |
| InChI | InChI=1S/C19H15O/c1-2-6-14(5-1)11-16-12-20-13-19(16)18-10-9-15-7-3-4-8-17(15)18/h1-11H,12-13H2/q-1/b16-11+,19-18+ |
| InChIKey | WBBIRKVTQIGESK-FLXQFUDPSA-N |
| XLogP | 4.30 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.33 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|